C22H27FN4O2 — CID 59401603
6-(3-fluorophenyl)-N-[(1R,3S)-3-[2-(methylamino)ethylcarbamoyl]cyclohexyl]pyridine-3-carboxamide (PubChem CID 59401603) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-N-[(1R,3S)-3-[2-(methylamino)ethylcarbamoyl]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 6-(3-fluorophenyl)-N-[(1R,3S)-3-[2-(methylamino)ethylcarbamoyl]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59401603 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 6-(3-fluorophenyl)-N-[(1R,3S)-3-[2-(methylamino)ethylcarbamoyl]cyclohexyl]pyridine-3-carboxamide |
| SMILES | CNCCNC(=O)[C@H]1CCC[C@@H](NC(=O)c2ccc(-c3cccc(F)c3)nc2)C1 |
| InChI | InChI=1S/C22H27FN4O2/c1-24-10-11-25-21(28)16-5-3-7-19(13-16)27-22(29)17-8-9-20(26-14-17)15-4-2-6-18(23)12-15/h2,4,6,8-9,12,14,16,19,24H,3,5,7,10-11,13H2,1H3,(H,25,28)(H,27,29)/t16-,19+/m0/s1 |
| InChIKey | QORNGTMNGKWRJD-QFBILLFUSA-N |
| XLogP | 2.51 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|