C20H23FN2O2 — CID 67070250
6-(3-fluorophenyl)-N-[3-(1-hydroxyethyl)cyclohexyl]pyridine-3-carboxamide (PubChem CID 67070250) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-N-[3-(1-hydroxyethyl)cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 6-(3-fluorophenyl)-N-[3-(1-hydroxyethyl)cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67070250 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 6-(3-fluorophenyl)-N-[3-(1-hydroxyethyl)cyclohexyl]pyridine-3-carboxamide |
| SMILES | CC(O)C1CCCC(NC(=O)c2ccc(-c3cccc(F)c3)nc2)C1 |
| InChI | InChI=1S/C20H23FN2O2/c1-13(24)14-4-3-7-18(11-14)23-20(25)16-8-9-19(22-12-16)15-5-2-6-17(21)10-15/h2,5-6,8-10,12-14,18,24H,3-4,7,11H2,1H3,(H,23,25) |
| InChIKey | KUEVCHSZXUWBLO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |