C18H17FN2O3 — CID 87257900
[(1R,3S)-3-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]cyclopentyl] formate (PubChem CID 87257900) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is [(1R,3S)-3-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]cyclopentyl] formate.
| Compound Name | [(1R,3S)-3-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]cyclopentyl] formate |
|---|---|
| PubChem CID | 87257900 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(1R,3S)-3-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]cyclopentyl] formate |
| SMILES | O=CO[C@@H]1CC[C@H](NC(=O)c2ccc(-c3cccc(F)c3)nc2)C1 |
| InChI | InChI=1S/C18H17FN2O3/c19-14-3-1-2-12(8-14)17-7-4-13(10-20-17)18(23)21-15-5-6-16(9-15)24-11-22/h1-4,7-8,10-11,15-16H,5-6,9H2,(H,21,23)/t15-,16+/m0/s1 |
| InChIKey | LXJOQQZWRNFCBB-JKSUJKDBSA-N |
| XLogP | 2.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|