C22H26FN3O3 — CID 68507339
6-(3-fluorophenyl)-N-[3-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]cyclohexyl]pyridine-3-carboxamide (PubChem CID 68507339) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-N-[3-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 6-(3-fluorophenyl)-N-[3-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68507339 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 6-(3-fluorophenyl)-N-[3-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]cyclohexyl]pyridine-3-carboxamide |
| SMILES | C[C@H](CO)NC(=O)C1CCCC(NC(=O)c2ccc(-c3cccc(F)c3)nc2)C1 |
| InChI | InChI=1S/C22H26FN3O3/c1-14(13-27)25-21(28)16-5-3-7-19(11-16)26-22(29)17-8-9-20(24-12-17)15-4-2-6-18(23)10-15/h2,4,6,8-10,12,14,16,19,27H,3,5,7,11,13H2,1H3,(H,25,28)(H,26,29)/t14-,16?,19?/m1/s1 |
| InChIKey | XTFKPTKUNHGDAT-ICXUMSERSA-N |
| XLogP | 2.67 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |