C16H31N3O4 — CID 118227156
tert-butyl N-[[(1R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]carbamate (PubChem CID 118227156) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl N-[[(1R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(1R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]carbamate |
|---|---|
| PubChem CID | 118227156 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | tert-butyl N-[[(1R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN[C@@H]1CCCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H31N3O4/c1-15(2,3)22-13(20)17-11-8-7-9-12(10-11)18-19-14(21)23-16(4,5)6/h11-12,18H,7-10H2,1-6H3,(H,17,20)(H,19,21)/t11?,12-/m1/s1 |
| InChIKey | YPMFTTHMUZTBKK-PIJUOVFKSA-N |
| XLogP | 2.85 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|