C11H21N3O4 — CID 150881139
[[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]amino]carbamic acid (PubChem CID 150881139) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is [[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]amino]carbamic acid.
| Compound Name | [[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]amino]carbamic acid |
|---|---|
| PubChem CID | 150881139 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | [[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]amino]carbamic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](NNC(=O)O)C1 |
| InChI | InChI=1S/C11H21N3O4/c1-11(2,3)18-10(17)12-7-4-5-8(6-7)13-14-9(15)16/h7-8,13-14H,4-6H2,1-3H3,(H,12,17)(H,15,16)/t7-,8+/m1/s1 |
| InChIKey | KWAQXBOPORBBER-SFYZADRCSA-N |
| XLogP | 1.20 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|