C12H23NO3 — CID 118263190
tert-butyl N-[(1R,3R)-3-hydroxy-4-methylcyclohexyl]carbamate (PubChem CID 118263190) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl N-[(1R,3R)-3-hydroxy-4-methylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3R)-3-hydroxy-4-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 118263190 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | tert-butyl N-[(1R,3R)-3-hydroxy-4-methylcyclohexyl]carbamate |
| SMILES | CC1CC[C@@H](NC(=O)OC(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C12H23NO3/c1-8-5-6-9(7-10(8)14)13-11(15)16-12(2,3)4/h8-10,14H,5-7H2,1-4H3,(H,13,15)/t8?,9-,10-/m1/s1 |
| InChIKey | CBZNOKAFOMSSLW-VXRWAFEHSA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |