C12H21NO4 — CID 15768172
tert-butyl N-(3,6-dihydroxycyclohept-4-en-1-yl)carbamate (PubChem CID 15768172) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is tert-butyl N-(3,6-dihydroxycyclohept-4-en-1-yl)carbamate.
| Compound Name | tert-butyl N-(3,6-dihydroxycyclohept-4-en-1-yl)carbamate |
|---|---|
| PubChem CID | 15768172 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | tert-butyl N-(3,6-dihydroxycyclohept-4-en-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(O)C=CC(O)C1 |
| InChI | InChI=1S/C12H21NO4/c1-12(2,3)17-11(16)13-8-6-9(14)4-5-10(15)7-8/h4-5,8-10,14-15H,6-7H2,1-3H3,(H,13,16) |
| InChIKey | LBUOVXSTPRNMMG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|