C10H19NO5 — CID 110144322
tert-butyl N-[(1R,2R,3S,4S)-2,3,4-trihydroxycyclopentyl]carbamate (PubChem CID 110144322) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,3S,4S)-2,3,4-trihydroxycyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,3S,4S)-2,3,4-trihydroxycyclopentyl]carbamate |
|---|---|
| PubChem CID | 110144322 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | tert-butyl N-[(1R,2R,3S,4S)-2,3,4-trihydroxycyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H19NO5/c1-10(2,3)16-9(15)11-5-4-6(12)8(14)7(5)13/h5-8,12-14H,4H2,1-3H3,(H,11,15)/t5-,6+,7-,8+/m1/s1 |
| InChIKey | MVBZHAVXVQYPSO-CWKFCGSDSA-N |
| XLogP | -0.63 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |