C11H19NO5 — CID 10634091
tert-butyl N-[(1R,3S,4S,5S,6S)-4,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]carbamate (PubChem CID 10634091) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S,4S,5S,6S)-4,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S,4S,5S,6S)-4,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 10634091 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | tert-butyl N-[(1R,3S,4S,5S,6S)-4,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H]2O[C@H]2[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO5/c1-11(2,3)17-10(15)12-5-4-6-9(16-6)8(14)7(5)13/h5-9,13-14H,4H2,1-3H3,(H,12,15)/t5-,6+,7-,8-,9+/m0/s1 |
| InChIKey | NZTHJLUHDBSSDF-QKAWAISNSA-N |
| XLogP | -0.23 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|