C9H17NO2 — CID 121309332
tert-butyl N-[(1R,2R)-2-methylcyclopropyl]carbamate (PubChem CID 121309332) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-methylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-2-methylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 121309332 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-methylcyclopropyl]carbamate |
| SMILES | C[C@@H]1C[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H17NO2/c1-6-5-7(6)10-8(11)12-9(2,3)4/h6-7H,5H2,1-4H3,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | ZKLOWZYRIPLSEG-RNFRBKRXSA-N |
| XLogP | 1.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |