C11H21NO2 — CID 162343214
tert-butyl N-[(1R,2S)-2-methylcyclopentyl]carbamate (PubChem CID 162343214) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-methylcyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-methylcyclopentyl]carbamate |
|---|---|
| PubChem CID | 162343214 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-methylcyclopentyl]carbamate |
| SMILES | C[C@H]1CCC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-8-6-5-7-9(8)12-10(13)14-11(2,3)4/h8-9H,5-7H2,1-4H3,(H,12,13)/t8-,9+/m0/s1 |
| InChIKey | GISXLZSEYIUGFI-DTWKUNHWSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |