C9H14F3NO2 — CID 126970282
tert-butyl N-[2-(trifluoromethyl)cyclopropyl]carbamate (PubChem CID 126970282) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is tert-butyl N-[2-(trifluoromethyl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-(trifluoromethyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 126970282 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | tert-butyl N-[2-(trifluoromethyl)cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2/c1-8(2,3)15-7(14)13-6-4-5(6)9(10,11)12/h5-6H,4H2,1-3H3,(H,13,14) |
| InChIKey | GCJUZGHULRVKGS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |