C15H25F3N2O2 — CID 107238283
tert-butyl N-[2-[[4-(trifluoromethyl)cyclohexyl]amino]cyclopropyl]carbamate (PubChem CID 107238283) has the molecular formula C15H25F3N2O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(trifluoromethyl)cyclohexyl]amino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(trifluoromethyl)cyclohexyl]amino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107238283 |
| Molecular Formula | C15H25F3N2O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl N-[2-[[4-(trifluoromethyl)cyclohexyl]amino]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H25F3N2O2/c1-14(2,3)22-13(21)20-12-8-11(12)19-10-6-4-9(5-7-10)15(16,17)18/h9-12,19H,4-8H2,1-3H3,(H,20,21) |
| InChIKey | BMEQQHTWYWJOGX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |