C11H19F3N2O2 — CID 99646092
tert-butyl N-[(3S,5S)-5-(trifluoromethyl)piperidin-3-yl]carbamate (PubChem CID 99646092) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is tert-butyl N-[(3S,5S)-5-(trifluoromethyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5S)-5-(trifluoromethyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 99646092 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | tert-butyl N-[(3S,5S)-5-(trifluoromethyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2O2/c1-10(2,3)18-9(17)16-8-4-7(5-15-6-8)11(12,13)14/h7-8,15H,4-6H2,1-3H3,(H,16,17)/t7-,8-/m0/s1 |
| InChIKey | CUNVTZVWJLBPQS-YUMQZZPRSA-N |
| XLogP | 2.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |