C10H17F3N2 — CID 142586354
N-but-1-en-2-yl-5-(trifluoromethyl)piperidin-3-amine (PubChem CID 142586354) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is N-but-1-en-2-yl-5-(trifluoromethyl)piperidin-3-amine.
| Compound Name | N-but-1-en-2-yl-5-(trifluoromethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 142586354 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | N-but-1-en-2-yl-5-(trifluoromethyl)piperidin-3-amine |
| SMILES | C=C(CC)NC1CNCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3N2/c1-3-7(2)15-9-4-8(5-14-6-9)10(11,12)13/h8-9,14-15H,2-6H2,1H3 |
| InChIKey | WUWQYCQGTCXUKA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |