C12H20F3NO — CID 100835824
(2S)-2-methyl-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]butanamide (PubChem CID 100835824) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is (2S)-2-methyl-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]butanamide.
| Compound Name | (2S)-2-methyl-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]butanamide |
|---|---|
| PubChem CID | 100835824 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (2S)-2-methyl-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]butanamide |
| SMILES | CC[C@H](C)C(=O)N[C@@H]1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3NO/c1-3-8(2)11(17)16-10-6-4-5-9(7-10)12(13,14)15/h8-10H,3-7H2,1-2H3,(H,16,17)/t8-,9+,10+/m0/s1 |
| InChIKey | OYCGSOSCFAZCGM-IVZWLZJFSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |