C12H18F3NO — CID 94606396
N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]cyclobutanecarboxamide (PubChem CID 94606396) has the molecular formula C12H18F3NO and a molecular weight of 249.28 g/mol. Its IUPAC name is N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]cyclobutanecarboxamide.
| Compound Name | N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 94606396 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]cyclobutanecarboxamide |
| SMILES | O=C(N[C@H]1CCC[C@H](C(F)(F)F)C1)C1CCC1 |
| InChI | InChI=1S/C12H18F3NO/c13-12(14,15)9-5-2-6-10(7-9)16-11(17)8-3-1-4-8/h8-10H,1-7H2,(H,16,17)/t9-,10-/m0/s1 |
| InChIKey | UVLSNPJVFANLDG-UWVGGRQHSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |