C13H22ClF3N2O — CID 119426864
N-piperidin-3-yl-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119426864) has the molecular formula C13H22ClF3N2O and a molecular weight of 314.78 g/mol. Its IUPAC name is N-piperidin-3-yl-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | N-piperidin-3-yl-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119426864 |
| Molecular Formula | C13H22ClF3N2O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-piperidin-3-yl-3-(trifluoromethyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCNC1)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H21F3N2O.ClH/c14-13(15,16)10-4-1-3-9(7-10)12(19)18-11-5-2-6-17-8-11;/h9-11,17H,1-8H2,(H,18,19);1H |
| InChIKey | REDFQSBKFSBVFF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |