C18H30F3NO — CID 55517058
4-tert-butyl-N-[3-(trifluoromethyl)cyclohexyl]cyclohexane-1-carboxamide (PubChem CID 55517058) has the molecular formula C18H30F3NO and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(trifluoromethyl)cyclohexyl]cyclohexane-1-carboxamide.
| Compound Name | 4-tert-butyl-N-[3-(trifluoromethyl)cyclohexyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 55517058 |
| Molecular Formula | C18H30F3NO |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 4-tert-butyl-N-[3-(trifluoromethyl)cyclohexyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)C1CCC(C(=O)NC2CCCC(C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C18H30F3NO/c1-17(2,3)13-9-7-12(8-10-13)16(23)22-15-6-4-5-14(11-15)18(19,20)21/h12-15H,4-11H2,1-3H3,(H,22,23) |
| InChIKey | NAJWTEPCGFKZSU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |