C13H23F3N2O — CID 76887112
2-amino-3,3-dimethyl-N-[3-(trifluoromethyl)cyclohexyl]butanamide (PubChem CID 76887112) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-amino-3,3-dimethyl-N-[3-(trifluoromethyl)cyclohexyl]butanamide.
| Compound Name | 2-amino-3,3-dimethyl-N-[3-(trifluoromethyl)cyclohexyl]butanamide |
|---|---|
| PubChem CID | 76887112 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-amino-3,3-dimethyl-N-[3-(trifluoromethyl)cyclohexyl]butanamide |
| SMILES | CC(C)(C)C(N)C(=O)NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H23F3N2O/c1-12(2,3)10(17)11(19)18-9-6-4-5-8(7-9)13(14,15)16/h8-10H,4-7,17H2,1-3H3,(H,18,19) |
| InChIKey | LPMLYKBODIRQLB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |