C11H22N2O3S — CID 77013077
2-amino-N-(1,1-dioxothian-3-yl)-3,3-dimethylbutanamide (PubChem CID 77013077) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-amino-N-(1,1-dioxothian-3-yl)-3,3-dimethylbutanamide.
| Compound Name | 2-amino-N-(1,1-dioxothian-3-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 77013077 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-amino-N-(1,1-dioxothian-3-yl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)C(N)C(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-11(2,3)9(12)10(14)13-8-5-4-6-17(15,16)7-8/h8-9H,4-7,12H2,1-3H3,(H,13,14) |
| InChIKey | XACWJYNRQCIZQR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |