C14H20N2O3S — CID 106151502
2-amino-N-(1,1-dioxothian-3-yl)-2-(4-methylphenyl)acetamide (PubChem CID 106151502) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-amino-N-(1,1-dioxothian-3-yl)-2-(4-methylphenyl)acetamide.
| Compound Name | 2-amino-N-(1,1-dioxothian-3-yl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 106151502 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-amino-N-(1,1-dioxothian-3-yl)-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(N)C(=O)NC2CCCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-10-4-6-11(7-5-10)13(15)14(17)16-12-3-2-8-20(18,19)9-12/h4-7,12-13H,2-3,8-9,15H2,1H3,(H,16,17) |
| InChIKey | VROOWXVFQQPYFM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |