C15H28N2O3S — CID 96547556
(2R)-N-[(3S)-1,1-dioxothian-3-yl]-3-methyl-2-piperidin-1-ylbutanamide (PubChem CID 96547556) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is (2R)-N-[(3S)-1,1-dioxothian-3-yl]-3-methyl-2-piperidin-1-ylbutanamide.
| Compound Name | (2R)-N-[(3S)-1,1-dioxothian-3-yl]-3-methyl-2-piperidin-1-ylbutanamide |
|---|---|
| PubChem CID | 96547556 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (2R)-N-[(3S)-1,1-dioxothian-3-yl]-3-methyl-2-piperidin-1-ylbutanamide |
| SMILES | CC(C)[C@H](C(=O)N[C@H]1CCCS(=O)(=O)C1)N1CCCCC1 |
| InChI | InChI=1S/C15H28N2O3S/c1-12(2)14(17-8-4-3-5-9-17)15(18)16-13-7-6-10-21(19,20)11-13/h12-14H,3-11H2,1-2H3,(H,16,18)/t13-,14+/m0/s1 |
| InChIKey | FUWSTCVZURLDFT-UONOGXRCSA-N |
| XLogP | 1.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |