C12H23N3O3S — CID 63924147
N-(1,1-dioxothian-3-yl)-2-piperazin-1-ylpropanamide (PubChem CID 63924147) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-2-piperazin-1-ylpropanamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 63924147 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-2-piperazin-1-ylpropanamide |
| SMILES | CC(C(=O)NC1CCCS(=O)(=O)C1)N1CCNCC1 |
| InChI | InChI=1S/C12H23N3O3S/c1-10(15-6-4-13-5-7-15)12(16)14-11-3-2-8-19(17,18)9-11/h10-11,13H,2-9H2,1H3,(H,14,16) |
| InChIKey | YCGQHSRECRJXQE-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |