C12H23N3O3S — CID 62131979
N-[(1,1-dioxothiolan-3-yl)methyl]-2-piperazin-1-ylpropanamide (PubChem CID 62131979) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-2-piperazin-1-ylpropanamide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 62131979 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2-piperazin-1-ylpropanamide |
| SMILES | CC(C(=O)NCC1CCS(=O)(=O)C1)N1CCNCC1 |
| InChI | InChI=1S/C12H23N3O3S/c1-10(15-5-3-13-4-6-15)12(16)14-8-11-2-7-19(17,18)9-11/h10-11,13H,2-9H2,1H3,(H,14,16) |
| InChIKey | GLQOQLNOJZHIJY-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |