C11H17N3O3S — CID 94037886
(2R)-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-pyrazol-1-ylpropanamide (PubChem CID 94037886) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2R)-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-pyrazol-1-ylpropanamide.
| Compound Name | (2R)-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 94037886 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2R)-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-pyrazol-1-ylpropanamide |
| SMILES | C[C@H](C(=O)NC[C@H]1CCS(=O)(=O)C1)n1cccn1 |
| InChI | InChI=1S/C11H17N3O3S/c1-9(14-5-2-4-13-14)11(15)12-7-10-3-6-18(16,17)8-10/h2,4-5,9-10H,3,6-8H2,1H3,(H,12,15)/t9-,10-/m1/s1 |
| InChIKey | HFHMHLWMAYPGRN-NXEZZACHSA-N |
| XLogP | -0.00 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |