C8H14BrNO3S — CID 107904735
2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]propanamide (PubChem CID 107904735) has the molecular formula C8H14BrNO3S and a molecular weight of 284.18 g/mol. Its IUPAC name is 2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]propanamide.
| Compound Name | 2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 107904735 |
| Molecular Formula | C8H14BrNO3S |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]propanamide |
| SMILES | CC(Br)C(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14BrNO3S/c1-6(9)8(11)10-4-7-2-3-14(12,13)5-7/h6-7H,2-5H2,1H3,(H,10,11) |
| InChIKey | KLZTWPBRFGQYEL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|