C10H18N2O3S2 — CID 62131441
2-carbamothioyl-N-[(1,1-dioxothiolan-3-yl)methyl]butanamide (PubChem CID 62131441) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-carbamothioyl-N-[(1,1-dioxothiolan-3-yl)methyl]butanamide.
| Compound Name | 2-carbamothioyl-N-[(1,1-dioxothiolan-3-yl)methyl]butanamide |
|---|---|
| PubChem CID | 62131441 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-carbamothioyl-N-[(1,1-dioxothiolan-3-yl)methyl]butanamide |
| SMILES | CCC(C(=O)NCC1CCS(=O)(=O)C1)C(N)=S |
| InChI | InChI=1S/C10H18N2O3S2/c1-2-8(9(11)16)10(13)12-5-7-3-4-17(14,15)6-7/h7-8H,2-6H2,1H3,(H2,11,16)(H,12,13) |
| InChIKey | DXPCEOBEQGEGHA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|