C10H19NO2S3 — CID 43828498
2-methylpropyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamodithioate (PubChem CID 43828498) has the molecular formula C10H19NO2S3 and a molecular weight of 281.47 g/mol. Its IUPAC name is 2-methylpropyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamodithioate.
| Compound Name | 2-methylpropyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamodithioate |
|---|---|
| PubChem CID | 43828498 |
| Molecular Formula | C10H19NO2S3 |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-methylpropyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamodithioate |
| SMILES | CC(C)CSC(=S)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO2S3/c1-8(2)6-15-10(14)11-5-9-3-4-16(12,13)7-9/h8-9H,3-7H2,1-2H3,(H,11,14) |
| InChIKey | QCBNSHDEQOVHAO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|