C12H26IN3O2S — CID 111178445
1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 111178445) has the molecular formula C12H26IN3O2S and a molecular weight of 403.33 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111178445 |
| Molecular Formula | C12H26IN3O2S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C12H25N3O2S.HI/c1-4-13-12(14-7-10(2)3)15-8-11-5-6-18(16,17)9-11;/h10-11H,4-9H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | DPBQGDCKDRCWRS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|