C20H31N3O2S — CID 111852916
1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[(1-phenylcyclopentyl)methyl]guanidine (PubChem CID 111852916) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[(1-phenylcyclopentyl)methyl]guanidine.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[(1-phenylcyclopentyl)methyl]guanidine |
|---|---|
| PubChem CID | 111852916 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[(1-phenylcyclopentyl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCCC1)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H31N3O2S/c1-2-21-19(22-14-17-10-13-26(24,25)15-17)23-16-20(11-6-7-12-20)18-8-4-3-5-9-18/h3-5,8-9,17H,2,6-7,10-16H2,1H3,(H2,21,22,23) |
| InChIKey | QEALXZCNJFOSAA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|