C18H28IN3O2S — CID 111855047
1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[(1-phenylcyclobutyl)methyl]guanidine;hydroiodide (PubChem CID 111855047) has the molecular formula C18H28IN3O2S and a molecular weight of 477.41 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[(1-phenylcyclobutyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[(1-phenylcyclobutyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111855047 |
| Molecular Formula | C18H28IN3O2S |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[(1-phenylcyclobutyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCS(=O)(=O)C1)NCC1(c2ccccc2)CCC1.I |
| InChI | InChI=1S/C18H27N3O2S.HI/c1-19-17(20-12-15-8-11-24(22,23)13-15)21-14-18(9-5-10-18)16-6-3-2-4-7-16;/h2-4,6-7,15H,5,8-14H2,1H3,(H2,19,20,21);1H |
| InChIKey | VUXOGAIWMSUSFL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|