C18H28IN3O2S — CID 111141182
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide (PubChem CID 111141182) has the molecular formula C18H28IN3O2S and a molecular weight of 477.41 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141182 |
| Molecular Formula | C18H28IN3O2S |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(1-phenylcyclopentyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccccc2)CCCC1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C18H27N3O2S.HI/c1-19-17(21-16-9-12-24(22,23)13-16)20-14-18(10-5-6-11-18)15-7-3-2-4-8-15;/h2-4,7-8,16H,5-6,9-14H2,1H3,(H2,19,20,21);1H |
| InChIKey | OEPNFVGXOUUESC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|