C20H32IN3O2S — CID 111143299
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[1-(2-methylphenyl)cyclohexyl]methyl]guanidine;hydroiodide (PubChem CID 111143299) has the molecular formula C20H32IN3O2S and a molecular weight of 505.47 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[1-(2-methylphenyl)cyclohexyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[1-(2-methylphenyl)cyclohexyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111143299 |
| Molecular Formula | C20H32IN3O2S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[1-(2-methylphenyl)cyclohexyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccccc2C)CCCCC1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C20H31N3O2S.HI/c1-16-8-4-5-9-18(16)20(11-6-3-7-12-20)15-22-19(21-2)23-17-10-13-26(24,25)14-17;/h4-5,8-9,17H,3,6-7,10-15H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | MSJASBMZELXPSH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|