C17H23IN4O2S2 — CID 111141536
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111141536) has the molecular formula C17H23IN4O2S2 and a molecular weight of 506.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141536 |
| Molecular Formula | C17H23IN4O2S2 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1sc(-c2ccccc2)nc1C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H22N4O2S2.HI/c1-12-15(24-16(20-12)13-6-4-3-5-7-13)10-19-17(18-2)21-14-8-9-25(22,23)11-14;/h3-7,14H,8-11H2,1-2H3,(H2,18,19,21);1H |
| InChIKey | HXXTZSQFMOHUOK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|