C18H25IN4O2S2 — CID 111141092
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111141092) has the molecular formula C18H25IN4O2S2 and a molecular weight of 520.46 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141092 |
| Molecular Formula | C18H25IN4O2S2 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1sc(-c2ccccc2)nc1C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C18H24N4O2S2.HI/c1-3-19-18(22-15-9-10-26(23,24)12-15)20-11-16-13(2)21-17(25-16)14-7-5-4-6-8-14;/h4-8,15H,3,9-12H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | RGDCWQSCZXAKBJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|