C16H21N3O3S — CID 111140537
2-(1-benzofuran-2-ylmethyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine (PubChem CID 111140537) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(1-benzofuran-2-ylmethyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine.
| Compound Name | 2-(1-benzofuran-2-ylmethyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111140537 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-(1-benzofuran-2-ylmethyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc2ccccc2o1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21N3O3S/c1-2-17-16(19-13-7-8-23(20,21)11-13)18-10-14-9-12-5-3-4-6-15(12)22-14/h3-6,9,13H,2,7-8,10-11H2,1H3,(H2,17,18,19) |
| InChIKey | GMCQBHJDUTYVOB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|