C20H32N4O2S — CID 111142990
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(piperidin-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111142990) has the molecular formula C20H32N4O2S and a molecular weight of 392.57 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(piperidin-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(piperidin-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111142990 |
| Molecular Formula | C20H32N4O2S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[2-(piperidin-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCCCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H32N4O2S/c1-2-21-20(23-19-10-13-27(25,26)16-19)22-14-17-8-4-5-9-18(17)15-24-11-6-3-7-12-24/h4-5,8-9,19H,2-3,6-7,10-16H2,1H3,(H2,21,22,23) |
| InChIKey | SEFMJIQZPCJYJY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|