C19H31IN4O4S2 — CID 111140462
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111140462) has the molecular formula C19H31IN4O4S2 and a molecular weight of 570.52 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111140462 |
| Molecular Formula | C19H31IN4O4S2 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N2CCCCC2)cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C19H30N4O4S2.HI/c1-2-20-19(22-17-10-13-28(24,25)15-17)21-14-16-6-8-18(9-7-16)29(26,27)23-11-4-3-5-12-23;/h6-9,17H,2-5,10-15H2,1H3,(H2,20,21,22);1H |
| InChIKey | ZUENAEFTEDXVPB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|