C17H26N4O4S2 — CID 111141027
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 111141027) has the molecular formula C17H26N4O4S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111141027 |
| Molecular Formula | C17H26N4O4S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N2CCCC2)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N4O4S2/c1-18-17(20-15-8-11-26(22,23)13-15)19-12-14-4-6-16(7-5-14)27(24,25)21-9-2-3-10-21/h4-7,15H,2-3,8-13H2,1H3,(H2,18,19,20) |
| InChIKey | QTEMDLPFFRMPDH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|