C17H24N4O3S — CID 111140259
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine (PubChem CID 111140259) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111140259 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(N2CCCC2=O)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N4O3S/c1-18-17(20-14-8-10-25(23,24)12-14)19-11-13-4-6-15(7-5-13)21-9-2-3-16(21)22/h4-7,14H,2-3,8-12H2,1H3,(H2,18,19,20) |
| InChIKey | DCRGYAQWRGUMQW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|