C15H21IN6O2S — CID 111141010
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111141010) has the molecular formula C15H21IN6O2S and a molecular weight of 476.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141010 |
| Molecular Formula | C15H21IN6O2S |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(-n2cncn2)cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H20N6O2S.HI/c1-16-15(20-13-6-7-24(22,23)9-13)18-8-12-2-4-14(5-3-12)21-11-17-10-19-21;/h2-5,10-11,13H,6-9H2,1H3,(H2,16,18,20);1H |
| InChIKey | LEZKRKNCXMXPAW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|