C13H21IN4O3S — CID 111142999
1-(1,1-dioxothiolan-3-yl)-3-[(6-methoxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111142999) has the molecular formula C13H21IN4O3S and a molecular weight of 440.31 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[(6-methoxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[(6-methoxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111142999 |
| Molecular Formula | C13H21IN4O3S |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[(6-methoxy-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OC)nc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C13H20N4O3S.HI/c1-14-13(17-11-5-6-21(18,19)9-11)16-8-10-3-4-12(20-2)15-7-10;/h3-4,7,11H,5-6,8-9H2,1-2H3,(H2,14,16,17);1H |
| InChIKey | FHSFBXDMKPHKIP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|