C17H28IN5O3S — CID 111140810
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111140810) has the molecular formula C17H28IN5O3S and a molecular weight of 509.41 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111140810 |
| Molecular Formula | C17H28IN5O3S |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(N2CCOC(C)C2)nc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H27N5O3S.HI/c1-13-11-22(6-7-25-13)16-4-3-14(9-19-16)10-20-17(18-2)21-15-5-8-26(23,24)12-15;/h3-4,9,13,15H,5-8,10-12H2,1-2H3,(H2,18,20,21);1H |
| InChIKey | ATCPSBKURNMDPW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|