C21H28FN5O — CID 111846633
1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111846633) has the molecular formula C21H28FN5O and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111846633 |
| Molecular Formula | C21H28FN5O |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(N2CCOC(C)C2)nc1)NCc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C21H28FN5O/c1-15-4-5-17(10-19(15)22)11-25-21(23-3)26-13-18-6-7-20(24-12-18)27-8-9-28-16(2)14-27/h4-7,10,12,16H,8-9,11,13-14H2,1-3H3,(H2,23,25,26) |
| InChIKey | WYACPRSGXBXBII-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|