C22H30FN5 — CID 111846631
1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111846631) has the molecular formula C22H30FN5 and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111846631 |
| Molecular Formula | C22H30FN5 |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(N2CCC(C)CC2)nc1)NCc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C22H30FN5/c1-16-8-10-28(11-9-16)21-7-6-19(14-25-21)15-27-22(24-3)26-13-18-5-4-17(2)20(23)12-18/h4-7,12,14,16H,8-11,13,15H2,1-3H3,(H2,24,26,27) |
| InChIKey | PAKWNZFQFCLKOF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|