C24H36IN5O3 — CID 111377430
2-methyl-1-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111377430) has the molecular formula C24H36IN5O3 and a molecular weight of 569.49 g/mol. Its IUPAC name is 2-methyl-1-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111377430 |
| Molecular Formula | C24H36IN5O3 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 2-methyl-1-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(N2CCC(C)CC2)nc1)NCc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C24H35N5O3.HI/c1-17-8-10-29(11-9-17)22-7-6-18(14-26-22)15-27-24(25-2)28-16-19-12-20(30-3)23(32-5)21(13-19)31-4;/h6-7,12-14,17H,8-11,15-16H2,1-5H3,(H2,25,27,28);1H |
| InChIKey | YGFKFJWHMPVODY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|