C14H20F3IN4O3S — CID 111142228
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111142228) has the molecular formula C14H20F3IN4O3S and a molecular weight of 508.30 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111142228 |
| Molecular Formula | C14H20F3IN4O3S |
| Molecular Weight | 508.30 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccnc(OCC(F)(F)F)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C14H19F3N4O3S.HI/c1-18-13(21-11-3-5-25(22,23)8-11)20-7-10-2-4-19-12(6-10)24-9-14(15,16)17;/h2,4,6,11H,3,5,7-9H2,1H3,(H2,18,20,21);1H |
| InChIKey | ZTYJVYNRAAXWMB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|