C16H24F3N5O2 — CID 111384517
N-tert-butyl-2-[[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 111384517) has the molecular formula C16H24F3N5O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111384517 |
| Molecular Formula | C16H24F3N5O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1ccnc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H24F3N5O2/c1-15(2,3)24-12(25)9-23-14(20-4)22-8-11-5-6-21-13(7-11)26-10-16(17,18)19/h5-7H,8-10H2,1-4H3,(H,24,25)(H2,20,22,23) |
| InChIKey | JYVCGPPKUJBOIO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|